About (3-amino-3-oxopropyl) 3-chloro-4-methylbenzoate
(3-amino-3-oxopropyl) 3-chloro-4-methylbenzoate (PubChem CID 71908061) has the molecular formula C11H12ClNO3
and a molecular weight of 241.67 g/mol. Its IUPAC name is (3-amino-3-oxopropyl) 3-chloro-4-methylbenzoate.
Molecular Properties
| Compound Name | (3-amino-3-oxopropyl) 3-chloro-4-methylbenzoate |
| PubChem CID | 71908061 |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | (3-amino-3-oxopropyl) 3-chloro-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCCC(N)=O)cc1Cl |
| InChI | InChI=1S/C11H12ClNO3/c1-7-2-3-8(6-9(7)12)11(15)16-5-4-10(13)14/h2-3,6H,4-5H2,1H3,(H2,13,14) |
| InChIKey | MUVCHWJQMKXQBI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.67 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-amino-3-oxopropyl) 3-chloro-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-3-oxopropyl) 3-chloro-4-methylbenzoate?
The IUPAC name of (3-amino-3-oxopropyl) 3-chloro-4-methylbenzoate (CID 71908061) is (3-amino-3-oxopropyl) 3-chloro-4-methylbenzoate.
What is the SMILES notation for (3-amino-3-oxopropyl) 3-chloro-4-methylbenzoate?
The canonical SMILES for (3-amino-3-oxopropyl) 3-chloro-4-methylbenzoate is Cc1ccc(C(=O)OCCC(N)=O)cc1Cl.
What is the InChIKey of (3-amino-3-oxopropyl) 3-chloro-4-methylbenzoate?
The InChIKey is MUVCHWJQMKXQBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO3/c1-7-2-3-8(6-9(7)12)11(15)16-5-4-10(13)14/h2-3,6H,4-5H2,1H3,(H2,13,14).
What are the key properties of (3-amino-3-oxopropyl) 3-chloro-4-methylbenzoate?
(3-amino-3-oxopropyl) 3-chloro-4-methylbenzoate has a molecular weight of 241.67 g/mol, XLogP of 1.68, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-3-oxopropyl) 3-chloro-4-methylbenzoate is sourced from PubChem (CID 71908061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).