C10H12Cl2O2 — CID 91234331
4-butoxy-3,5-dichlorophenol (PubChem CID 91234331) has the molecular formula C10H12Cl2O2 and a molecular weight of 235.11 g/mol. Its IUPAC name is 4-butoxy-3,5-dichlorophenol.
| Compound Name | 4-butoxy-3,5-dichlorophenol |
|---|---|
| PubChem CID | 91234331 |
| Molecular Formula | C10H12Cl2O2 |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 4-butoxy-3,5-dichlorophenol |
| SMILES | CCCCOc1c(Cl)cc(O)cc1Cl |
| InChI | InChI=1S/C10H12Cl2O2/c1-2-3-4-14-10-8(11)5-7(13)6-9(10)12/h5-6,13H,2-4H2,1H3 |
| InChIKey | YNFSDXHSMBKCCT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|