C16H24Cl2O5 — CID 23282379
3,5-dichloro-4-[4-(2,2-diethoxyethoxy)butoxy]phenol (PubChem CID 23282379) has the molecular formula C16H24Cl2O5 and a molecular weight of 367.27 g/mol. Its IUPAC name is 3,5-dichloro-4-[4-(2,2-diethoxyethoxy)butoxy]phenol.
| Compound Name | 3,5-dichloro-4-[4-(2,2-diethoxyethoxy)butoxy]phenol |
|---|---|
| PubChem CID | 23282379 |
| Molecular Formula | C16H24Cl2O5 |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 3,5-dichloro-4-[4-(2,2-diethoxyethoxy)butoxy]phenol |
| SMILES | CCOC(COCCCCOc1c(Cl)cc(O)cc1Cl)OCC |
| InChI | InChI=1S/C16H24Cl2O5/c1-3-21-15(22-4-2)11-20-7-5-6-8-23-16-13(17)9-12(19)10-14(16)18/h9-10,15,19H,3-8,11H2,1-2H3 |
| InChIKey | NCJCLBHFDGONLA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|