C14H21ClO5 — CID 114459550
[3-chloro-4-(2,2-diethoxyethoxy)-5-methoxyphenyl]methanol (PubChem CID 114459550) has the molecular formula C14H21ClO5 and a molecular weight of 304.77 g/mol. Its IUPAC name is [3-chloro-4-(2,2-diethoxyethoxy)-5-methoxyphenyl]methanol.
| Compound Name | [3-chloro-4-(2,2-diethoxyethoxy)-5-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 114459550 |
| Molecular Formula | C14H21ClO5 |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | [3-chloro-4-(2,2-diethoxyethoxy)-5-methoxyphenyl]methanol |
| SMILES | CCOC(COc1c(Cl)cc(CO)cc1OC)OCC |
| InChI | InChI=1S/C14H21ClO5/c1-4-18-13(19-5-2)9-20-14-11(15)6-10(8-16)7-12(14)17-3/h6-7,13,16H,4-5,8-9H2,1-3H3 |
| InChIKey | VMUOVCMLDSSESP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|