C10H10Cl4O — CID 91736828
2-butoxy-1,3,4,5-tetrachlorobenzene (PubChem CID 91736828) has the molecular formula C10H10Cl4O and a molecular weight of 288.00 g/mol. Its IUPAC name is 2-butoxy-1,3,4,5-tetrachlorobenzene.
| Compound Name | 2-butoxy-1,3,4,5-tetrachlorobenzene |
|---|---|
| PubChem CID | 91736828 |
| Molecular Formula | C10H10Cl4O |
| Molecular Weight | 288.00 g/mol |
| Exact Mass | 285.95 |
| IUPAC Name | 2-butoxy-1,3,4,5-tetrachlorobenzene |
| SMILES | CCCCOc1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C10H10Cl4O/c1-2-3-4-15-10-7(12)5-6(11)8(13)9(10)14/h5H,2-4H2,1H3 |
| InChIKey | DPCNRLFWVPYYER-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.00 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|