About 2-butoxy-1,3,4,5-tetrachlorobenzene
2-butoxy-1,3,4,5-tetrachlorobenzene (PubChem CID 91736828) has the molecular formula C10H10Cl4O
and a molecular weight of 288.00 g/mol. Its IUPAC name is 2-butoxy-1,3,4,5-tetrachlorobenzene.
Molecular Properties
| Compound Name | 2-butoxy-1,3,4,5-tetrachlorobenzene |
| PubChem CID | 91736828 |
| Molecular Formula | C10H10Cl4O |
| Molecular Weight | 288.00 g/mol |
| Exact Mass | 285.95 |
| IUPAC Name | 2-butoxy-1,3,4,5-tetrachlorobenzene |
| SMILES | CCCCOc1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C10H10Cl4O/c1-2-3-4-15-10-7(12)5-6(11)8(13)9(10)14/h5H,2-4H2,1H3 |
| InChIKey | DPCNRLFWVPYYER-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.00 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-1,3,4,5-tetrachlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-1,3,4,5-tetrachlorobenzene?
The IUPAC name of 2-butoxy-1,3,4,5-tetrachlorobenzene (CID 91736828) is 2-butoxy-1,3,4,5-tetrachlorobenzene.
What is the SMILES notation for 2-butoxy-1,3,4,5-tetrachlorobenzene?
The canonical SMILES for 2-butoxy-1,3,4,5-tetrachlorobenzene is CCCCOc1c(Cl)cc(Cl)c(Cl)c1Cl.
What is the InChIKey of 2-butoxy-1,3,4,5-tetrachlorobenzene?
The InChIKey is DPCNRLFWVPYYER-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl4O/c1-2-3-4-15-10-7(12)5-6(11)8(13)9(10)14/h5H,2-4H2,1H3.
What are the key properties of 2-butoxy-1,3,4,5-tetrachlorobenzene?
2-butoxy-1,3,4,5-tetrachlorobenzene has a molecular weight of 288.00 g/mol, XLogP of 5.48, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-1,3,4,5-tetrachlorobenzene is sourced from PubChem (CID 91736828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).