C14H17Cl5O — CID 19820106
1,2,3,4,5-pentachloro-6-octoxybenzene (PubChem CID 19820106) has the molecular formula C14H17Cl5O and a molecular weight of 378.55 g/mol. Its IUPAC name is 1,2,3,4,5-pentachloro-6-octoxybenzene.
| Compound Name | 1,2,3,4,5-pentachloro-6-octoxybenzene |
|---|---|
| PubChem CID | 19820106 |
| Molecular Formula | C14H17Cl5O |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 1,2,3,4,5-pentachloro-6-octoxybenzene |
| SMILES | CCCCCCCCOc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C14H17Cl5O/c1-2-3-4-5-6-7-8-20-14-12(18)10(16)9(15)11(17)13(14)19/h2-8H2,1H3 |
| InChIKey | AABLKURHQOKLBN-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|