C29H29Cl5O5 — CID 43835969
[4-[2-(2,3,4,5,6-pentachlorophenoxy)ethoxy]phenyl] 4-octoxybenzoate (PubChem CID 43835969) has the molecular formula C29H29Cl5O5 and a molecular weight of 634.81 g/mol. Its IUPAC name is [4-[2-(2,3,4,5,6-pentachlorophenoxy)ethoxy]phenyl] 4-octoxybenzoate.
| Compound Name | [4-[2-(2,3,4,5,6-pentachlorophenoxy)ethoxy]phenyl] 4-octoxybenzoate |
|---|---|
| PubChem CID | 43835969 |
| Molecular Formula | C29H29Cl5O5 |
| Molecular Weight | 634.81 g/mol |
| Exact Mass | 632.05 |
| IUPAC Name | [4-[2-(2,3,4,5,6-pentachlorophenoxy)ethoxy]phenyl] 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(OCCOc3c(Cl)c(Cl)c(Cl)c(Cl)c3Cl)cc2)cc1 |
| InChI | InChI=1S/C29H29Cl5O5/c1-2-3-4-5-6-7-16-36-20-10-8-19(9-11-20)29(35)39-22-14-12-21(13-15-22)37-17-18-38-28-26(33)24(31)23(30)25(32)27(28)34/h8-15H,2-7,16-18H2,1H3 |
| InChIKey | SMANEFSMJAABEP-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.81 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|