About 2,3-dihexoxy-1,4-diiodobenzene
2,3-dihexoxy-1,4-diiodobenzene (PubChem CID 24814249) has the molecular formula C18H28I2O2
and a molecular weight of 530.23 g/mol. Its IUPAC name is 2,3-dihexoxy-1,4-diiodobenzene.
Molecular Properties
| Compound Name | 2,3-dihexoxy-1,4-diiodobenzene |
| PubChem CID | 24814249 |
| Molecular Formula | C18H28I2O2 |
| Molecular Weight | 530.23 g/mol |
| Exact Mass | 530.02 |
| IUPAC Name | 2,3-dihexoxy-1,4-diiodobenzene |
| SMILES | CCCCCCOc1c(I)ccc(I)c1OCCCCCC |
| InChI | InChI=1S/C18H28I2O2/c1-3-5-7-9-13-21-17-15(19)11-12-16(20)18(17)22-14-10-8-6-4-2/h11-12H,3-10,13-14H2,1-2H3 |
| InChIKey | WFXPGVWWTWVEOH-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.23 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihexoxy-1,4-diiodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihexoxy-1,4-diiodobenzene?
The IUPAC name of 2,3-dihexoxy-1,4-diiodobenzene (CID 24814249) is 2,3-dihexoxy-1,4-diiodobenzene.
What is the SMILES notation for 2,3-dihexoxy-1,4-diiodobenzene?
The canonical SMILES for 2,3-dihexoxy-1,4-diiodobenzene is CCCCCCOc1c(I)ccc(I)c1OCCCCCC.
What is the InChIKey of 2,3-dihexoxy-1,4-diiodobenzene?
The InChIKey is WFXPGVWWTWVEOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28I2O2/c1-3-5-7-9-13-21-17-15(19)11-12-16(20)18(17)22-14-10-8-6-4-2/h11-12H,3-10,13-14H2,1-2H3.
What are the key properties of 2,3-dihexoxy-1,4-diiodobenzene?
2,3-dihexoxy-1,4-diiodobenzene has a molecular weight of 530.23 g/mol, XLogP of 6.81, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihexoxy-1,4-diiodobenzene is sourced from PubChem (CID 24814249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).