C18H28I2O2 — CID 24814249
2,3-dihexoxy-1,4-diiodobenzene (PubChem CID 24814249) has the molecular formula C18H28I2O2 and a molecular weight of 530.23 g/mol. Its IUPAC name is 2,3-dihexoxy-1,4-diiodobenzene.
| Compound Name | 2,3-dihexoxy-1,4-diiodobenzene |
|---|---|
| PubChem CID | 24814249 |
| Molecular Formula | C18H28I2O2 |
| Molecular Weight | 530.23 g/mol |
| Exact Mass | 530.02 |
| IUPAC Name | 2,3-dihexoxy-1,4-diiodobenzene |
| SMILES | CCCCCCOc1c(I)ccc(I)c1OCCCCCC |
| InChI | InChI=1S/C18H28I2O2/c1-3-5-7-9-13-21-17-15(19)11-12-16(20)18(17)22-14-10-8-6-4-2/h11-12H,3-10,13-14H2,1-2H3 |
| InChIKey | WFXPGVWWTWVEOH-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.23 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|