C18H27I3O — CID 139999122
2-dodecoxy-1,3,5-triiodobenzene (PubChem CID 139999122) has the molecular formula C18H27I3O and a molecular weight of 640.12 g/mol. Its IUPAC name is 2-dodecoxy-1,3,5-triiodobenzene.
| Compound Name | 2-dodecoxy-1,3,5-triiodobenzene |
|---|---|
| PubChem CID | 139999122 |
| Molecular Formula | C18H27I3O |
| Molecular Weight | 640.12 g/mol |
| Exact Mass | 639.92 |
| IUPAC Name | 2-dodecoxy-1,3,5-triiodobenzene |
| SMILES | CCCCCCCCCCCCOc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C18H27I3O/c1-2-3-4-5-6-7-8-9-10-11-12-22-18-16(20)13-15(19)14-17(18)21/h13-14H,2-12H2,1H3 |
| InChIKey | DWRKJVRDOFSWIV-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.12 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|