C20H20I6O5 — CID 18987005
1,3,5-triiodo-2-[2-[2-[2-[2-(2,4,6-triiodophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]benzene (PubChem CID 18987005) has the molecular formula C20H20I6O5 and a molecular weight of 1101.80 g/mol. Its IUPAC name is 1,3,5-triiodo-2-[2-[2-[2-[2-(2,4,6-triiodophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]benzene.
| Compound Name | 1,3,5-triiodo-2-[2-[2-[2-[2-(2,4,6-triiodophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]benzene |
|---|---|
| PubChem CID | 18987005 |
| Molecular Formula | C20H20I6O5 |
| Molecular Weight | 1101.80 g/mol |
| Exact Mass | 1101.56 |
| IUPAC Name | 1,3,5-triiodo-2-[2-[2-[2-[2-(2,4,6-triiodophenoxy)ethoxy]ethoxy]ethoxy]ethoxy]benzene |
| SMILES | Ic1cc(I)c(OCCOCCOCCOCCOc2c(I)cc(I)cc2I)c(I)c1 |
| InChI | InChI=1S/C20H20I6O5/c21-13-9-15(23)19(16(24)10-13)30-7-5-28-3-1-27-2-4-29-6-8-31-20-17(25)11-14(22)12-18(20)26/h9-12H,1-8H2 |
| InChIKey | DCTUWJSQVLZPDX-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1101.80 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|