C12H15I3O — CID 18999254
2-hexoxy-1,3,5-triiodobenzene (PubChem CID 18999254) has the molecular formula C12H15I3O and a molecular weight of 555.96 g/mol. Its IUPAC name is 2-hexoxy-1,3,5-triiodobenzene.
| Compound Name | 2-hexoxy-1,3,5-triiodobenzene |
|---|---|
| PubChem CID | 18999254 |
| Molecular Formula | C12H15I3O |
| Molecular Weight | 555.96 g/mol |
| Exact Mass | 555.83 |
| IUPAC Name | 2-hexoxy-1,3,5-triiodobenzene |
| SMILES | CCCCCCOc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C12H15I3O/c1-2-3-4-5-6-16-12-10(14)7-9(13)8-11(12)15/h7-8H,2-6H2,1H3 |
| InChIKey | WHLGJTZCYYFSOP-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.96 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|