C16H21I2NO2 — CID 154212116
3,5-diiodo-4-(octoxymethoxy)benzonitrile (PubChem CID 154212116) has the molecular formula C16H21I2NO2 and a molecular weight of 513.16 g/mol. Its IUPAC name is 3,5-diiodo-4-(octoxymethoxy)benzonitrile.
| Compound Name | 3,5-diiodo-4-(octoxymethoxy)benzonitrile |
|---|---|
| PubChem CID | 154212116 |
| Molecular Formula | C16H21I2NO2 |
| Molecular Weight | 513.16 g/mol |
| Exact Mass | 512.97 |
| IUPAC Name | 3,5-diiodo-4-(octoxymethoxy)benzonitrile |
| SMILES | CCCCCCCCOCOc1c(I)cc(C#N)cc1I |
| InChI | InChI=1S/C16H21I2NO2/c1-2-3-4-5-6-7-8-20-12-21-16-14(17)9-13(11-19)10-15(16)18/h9-10H,2-8,12H2,1H3 |
| InChIKey | AYAMBWUNKGQKAM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.16 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|