C15H21I3O — CID 19959848
1,3,5-triiodo-2-nonan-3-yloxybenzene (PubChem CID 19959848) has the molecular formula C15H21I3O and a molecular weight of 598.04 g/mol. Its IUPAC name is 1,3,5-triiodo-2-nonan-3-yloxybenzene.
| Compound Name | 1,3,5-triiodo-2-nonan-3-yloxybenzene |
|---|---|
| PubChem CID | 19959848 |
| Molecular Formula | C15H21I3O |
| Molecular Weight | 598.04 g/mol |
| Exact Mass | 597.87 |
| IUPAC Name | 1,3,5-triiodo-2-nonan-3-yloxybenzene |
| SMILES | CCCCCCC(CC)Oc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C15H21I3O/c1-3-5-6-7-8-12(4-2)19-15-13(17)9-11(16)10-14(15)18/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | FPQHNVQZKFOUCR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.04 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|