About 4-octan-3-yloxyphenol
4-octan-3-yloxyphenol (PubChem CID 54268247) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is 4-octan-3-yloxyphenol.
Molecular Properties
| Compound Name | 4-octan-3-yloxyphenol |
| PubChem CID | 54268247 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 4-octan-3-yloxyphenol |
| SMILES | CCCCCC(CC)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C14H22O2/c1-3-5-6-7-13(4-2)16-14-10-8-12(15)9-11-14/h8-11,13,15H,3-7H2,1-2H3 |
| InChIKey | RIHDOUAPWZMWAQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-octan-3-yloxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-octan-3-yloxyphenol?
The IUPAC name of 4-octan-3-yloxyphenol (CID 54268247) is 4-octan-3-yloxyphenol.
What is the SMILES notation for 4-octan-3-yloxyphenol?
The canonical SMILES for 4-octan-3-yloxyphenol is CCCCCC(CC)Oc1ccc(O)cc1.
What is the InChIKey of 4-octan-3-yloxyphenol?
The InChIKey is RIHDOUAPWZMWAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2/c1-3-5-6-7-13(4-2)16-14-10-8-12(15)9-11-14/h8-11,13,15H,3-7H2,1-2H3.
What are the key properties of 4-octan-3-yloxyphenol?
4-octan-3-yloxyphenol has a molecular weight of 222.33 g/mol, XLogP of 4.13, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-octan-3-yloxyphenol is sourced from PubChem (CID 54268247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).