About undecan-6-yloxybenzene
undecan-6-yloxybenzene (PubChem CID 130316504) has the molecular formula C17H28O
and a molecular weight of 248.41 g/mol. Its IUPAC name is undecan-6-yloxybenzene.
Molecular Properties
| Compound Name | undecan-6-yloxybenzene |
| PubChem CID | 130316504 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | undecan-6-yloxybenzene |
| SMILES | CCCCCC(CCCCC)Oc1ccccc1 |
| InChI | InChI=1S/C17H28O/c1-3-5-8-12-16(13-9-6-4-2)18-17-14-10-7-11-15-17/h7,10-11,14-16H,3-6,8-9,12-13H2,1-2H3 |
| InChIKey | QSUMCYVUAZDLCM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze undecan-6-yloxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undecan-6-yloxybenzene?
The IUPAC name of undecan-6-yloxybenzene (CID 130316504) is undecan-6-yloxybenzene.
What is the SMILES notation for undecan-6-yloxybenzene?
The canonical SMILES for undecan-6-yloxybenzene is CCCCCC(CCCCC)Oc1ccccc1.
What is the InChIKey of undecan-6-yloxybenzene?
The InChIKey is QSUMCYVUAZDLCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O/c1-3-5-8-12-16(13-9-6-4-2)18-17-14-10-7-11-15-17/h7,10-11,14-16H,3-6,8-9,12-13H2,1-2H3.
What are the key properties of undecan-6-yloxybenzene?
undecan-6-yloxybenzene has a molecular weight of 248.41 g/mol, XLogP of 5.59, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for undecan-6-yloxybenzene is sourced from PubChem (CID 130316504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).