C18H30NaO4S — CID 172702107
CID 172702107 (PubChem CID 172702107) has the molecular formula C18H30NaO4S and a molecular weight of 365.49 g/mol.
| Compound Name | CID 172702107 |
|---|---|
| PubChem CID | 172702107 |
| Molecular Formula | C18H30NaO4S |
| Molecular Weight | 365.49 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCC(CCS(=O)(=O)O)Oc1ccccc1.[Na] |
| InChI | InChI=1S/C18H30O4S.Na/c1-2-3-4-5-6-7-9-14-18(15-16-23(19,20)21)22-17-12-10-8-11-13-17;/h8,10-13,18H,2-7,9,14-16H2,1H3,(H,19,20,21); |
| InChIKey | DCFJTTIQPCOJBT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|