About decan-2-yloxybenzene
decan-2-yloxybenzene (PubChem CID 12838331) has the molecular formula C16H26O
and a molecular weight of 234.38 g/mol. Its IUPAC name is decan-2-yloxybenzene.
Molecular Properties
| Compound Name | decan-2-yloxybenzene |
| PubChem CID | 12838331 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | decan-2-yloxybenzene |
| SMILES | CCCCCCCCC(C)Oc1ccccc1 |
| InChI | InChI=1S/C16H26O/c1-3-4-5-6-7-9-12-15(2)17-16-13-10-8-11-14-16/h8,10-11,13-15H,3-7,9,12H2,1-2H3 |
| InChIKey | KXONIMNSDFBFLS-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decan-2-yloxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-2-yloxybenzene?
The IUPAC name of decan-2-yloxybenzene (CID 12838331) is decan-2-yloxybenzene.
What is the SMILES notation for decan-2-yloxybenzene?
The canonical SMILES for decan-2-yloxybenzene is CCCCCCCCC(C)Oc1ccccc1.
What is the InChIKey of decan-2-yloxybenzene?
The InChIKey is KXONIMNSDFBFLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O/c1-3-4-5-6-7-9-12-15(2)17-16-13-10-8-11-14-16/h8,10-11,13-15H,3-7,9,12H2,1-2H3.
What are the key properties of decan-2-yloxybenzene?
decan-2-yloxybenzene has a molecular weight of 234.38 g/mol, XLogP of 5.20, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for decan-2-yloxybenzene is sourced from PubChem (CID 12838331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).