About 1-methoxydecoxybenzene
1-methoxydecoxybenzene (PubChem CID 24977925) has the molecular formula C17H28O2
and a molecular weight of 264.41 g/mol. Its IUPAC name is 1-methoxydecoxybenzene.
Molecular Properties
| Compound Name | 1-methoxydecoxybenzene |
| PubChem CID | 24977925 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 1-methoxydecoxybenzene |
| SMILES | CCCCCCCCCC(OC)Oc1ccccc1 |
| InChI | InChI=1S/C17H28O2/c1-3-4-5-6-7-8-12-15-17(18-2)19-16-13-10-9-11-14-16/h9-11,13-14,17H,3-8,12,15H2,1-2H3 |
| InChIKey | XTJFDBYBPQAHED-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxydecoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxydecoxybenzene?
The IUPAC name of 1-methoxydecoxybenzene (CID 24977925) is 1-methoxydecoxybenzene.
What is the SMILES notation for 1-methoxydecoxybenzene?
The canonical SMILES for 1-methoxydecoxybenzene is CCCCCCCCCC(OC)Oc1ccccc1.
What is the InChIKey of 1-methoxydecoxybenzene?
The InChIKey is XTJFDBYBPQAHED-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O2/c1-3-4-5-6-7-8-12-15-17(18-2)19-16-13-10-9-11-14-16/h9-11,13-14,17H,3-8,12,15H2,1-2H3.
What are the key properties of 1-methoxydecoxybenzene?
1-methoxydecoxybenzene has a molecular weight of 264.41 g/mol, XLogP of 5.18, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxydecoxybenzene is sourced from PubChem (CID 24977925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).