About 2-phenoxyundecanal
2-phenoxyundecanal (PubChem CID 57130450) has the molecular formula C17H26O2
and a molecular weight of 262.39 g/mol. Its IUPAC name is 2-phenoxyundecanal.
Molecular Properties
| Compound Name | 2-phenoxyundecanal |
| PubChem CID | 57130450 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 2-phenoxyundecanal |
| SMILES | CCCCCCCCCC(C=O)Oc1ccccc1 |
| InChI | InChI=1S/C17H26O2/c1-2-3-4-5-6-7-9-14-17(15-18)19-16-12-10-8-11-13-16/h8,10-13,15,17H,2-7,9,14H2,1H3 |
| InChIKey | RRSLOKCHCYEGEY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-phenoxyundecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxyundecanal?
The IUPAC name of 2-phenoxyundecanal (CID 57130450) is 2-phenoxyundecanal.
What is the SMILES notation for 2-phenoxyundecanal?
The canonical SMILES for 2-phenoxyundecanal is CCCCCCCCCC(C=O)Oc1ccccc1.
What is the InChIKey of 2-phenoxyundecanal?
The InChIKey is RRSLOKCHCYEGEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O2/c1-2-3-4-5-6-7-9-14-17(15-18)19-16-12-10-8-11-13-16/h8,10-13,15,17H,2-7,9,14H2,1H3.
What are the key properties of 2-phenoxyundecanal?
2-phenoxyundecanal has a molecular weight of 262.39 g/mol, XLogP of 4.77, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxyundecanal is sourced from PubChem (CID 57130450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).