About 2-phenoxynonanenitrile
2-phenoxynonanenitrile (PubChem CID 68573362) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-phenoxynonanenitrile.
Molecular Properties
| Compound Name | 2-phenoxynonanenitrile |
| PubChem CID | 68573362 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2-phenoxynonanenitrile |
| SMILES | CCCCCCCC(C#N)Oc1ccccc1 |
| InChI | InChI=1S/C15H21NO/c1-2-3-4-5-7-12-15(13-16)17-14-10-8-6-9-11-14/h6,8-11,15H,2-5,7,12H2,1H3 |
| InChIKey | WLHUABFOUNRNBW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-phenoxynonanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxynonanenitrile?
The IUPAC name of 2-phenoxynonanenitrile (CID 68573362) is 2-phenoxynonanenitrile.
What is the SMILES notation for 2-phenoxynonanenitrile?
The canonical SMILES for 2-phenoxynonanenitrile is CCCCCCCC(C#N)Oc1ccccc1.
What is the InChIKey of 2-phenoxynonanenitrile?
The InChIKey is WLHUABFOUNRNBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO/c1-2-3-4-5-7-12-15(13-16)17-14-10-8-6-9-11-14/h6,8-11,15H,2-5,7,12H2,1H3.
What are the key properties of 2-phenoxynonanenitrile?
2-phenoxynonanenitrile has a molecular weight of 231.34 g/mol, XLogP of 4.32, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxynonanenitrile is sourced from PubChem (CID 68573362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).