C20H32O — CID 158926907
3,3-dimethyldodec-1-en-4-yloxybenzene (PubChem CID 158926907) has the molecular formula C20H32O and a molecular weight of 288.47 g/mol. Its IUPAC name is 3,3-dimethyldodec-1-en-4-yloxybenzene.
| Compound Name | 3,3-dimethyldodec-1-en-4-yloxybenzene |
|---|---|
| PubChem CID | 158926907 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 3,3-dimethyldodec-1-en-4-yloxybenzene |
| SMILES | C=CC(C)(C)C(CCCCCCCC)Oc1ccccc1 |
| InChI | InChI=1S/C20H32O/c1-5-7-8-9-10-14-17-19(20(3,4)6-2)21-18-15-12-11-13-16-18/h6,11-13,15-16,19H,2,5,7-10,14,17H2,1,3-4H3 |
| InChIKey | JIOHABSRQOBTSZ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|