C19H32O4 — CID 70520234
2-(hydroxymethyl)-2-(1-phenoxynonyl)propane-1,3-diol (PubChem CID 70520234) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-(1-phenoxynonyl)propane-1,3-diol.
| Compound Name | 2-(hydroxymethyl)-2-(1-phenoxynonyl)propane-1,3-diol |
|---|---|
| PubChem CID | 70520234 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 2-(hydroxymethyl)-2-(1-phenoxynonyl)propane-1,3-diol |
| SMILES | CCCCCCCCC(Oc1ccccc1)C(CO)(CO)CO |
| InChI | InChI=1S/C19H32O4/c1-2-3-4-5-6-10-13-18(19(14-20,15-21)16-22)23-17-11-8-7-9-12-17/h7-9,11-12,18,20-22H,2-6,10,13-16H2,1H3 |
| InChIKey | IABQUCVHZJYDJS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|