C22H38O5 — CID 150429547
4-(1,1,1-triethoxydecan-2-yloxy)phenol (PubChem CID 150429547) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is 4-(1,1,1-triethoxydecan-2-yloxy)phenol.
| Compound Name | 4-(1,1,1-triethoxydecan-2-yloxy)phenol |
|---|---|
| PubChem CID | 150429547 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 4-(1,1,1-triethoxydecan-2-yloxy)phenol |
| SMILES | CCCCCCCCC(Oc1ccc(O)cc1)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C22H38O5/c1-5-9-10-11-12-13-14-21(27-20-17-15-19(23)16-18-20)22(24-6-2,25-7-3)26-8-4/h15-18,21,23H,5-14H2,1-4H3 |
| InChIKey | HJMPJWWUFDNCEX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|