C23H27F3O4 — CID 139613785
1,1,1-trifluorodecan-2-yl 4-(4-hydroxyphenyl)benzenecarboperoxoate (PubChem CID 139613785) has the molecular formula C23H27F3O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is 1,1,1-trifluorodecan-2-yl 4-(4-hydroxyphenyl)benzenecarboperoxoate.
| Compound Name | 1,1,1-trifluorodecan-2-yl 4-(4-hydroxyphenyl)benzenecarboperoxoate |
|---|---|
| PubChem CID | 139613785 |
| Molecular Formula | C23H27F3O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1,1,1-trifluorodecan-2-yl 4-(4-hydroxyphenyl)benzenecarboperoxoate |
| SMILES | CCCCCCCCC(OOC(=O)c1ccc(-c2ccc(O)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C23H27F3O4/c1-2-3-4-5-6-7-8-21(23(24,25)26)29-30-22(28)19-11-9-17(10-12-19)18-13-15-20(27)16-14-18/h9-16,21,27H,2-8H2,1H3 |
| InChIKey | HBZWHBMWDCTVAG-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|