C20H21F3O4 — CID 14693237
6-(1,1,1-trifluorooctan-2-yloxycarbonyl)naphthalene-2-carboxylic acid (PubChem CID 14693237) has the molecular formula C20H21F3O4 and a molecular weight of 382.38 g/mol. Its IUPAC name is 6-(1,1,1-trifluorooctan-2-yloxycarbonyl)naphthalene-2-carboxylic acid.
| Compound Name | 6-(1,1,1-trifluorooctan-2-yloxycarbonyl)naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 14693237 |
| Molecular Formula | C20H21F3O4 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 6-(1,1,1-trifluorooctan-2-yloxycarbonyl)naphthalene-2-carboxylic acid |
| SMILES | CCCCCCC(OC(=O)c1ccc2cc(C(=O)O)ccc2c1)C(F)(F)F |
| InChI | InChI=1S/C20H21F3O4/c1-2-3-4-5-6-17(20(21,22)23)27-19(26)16-10-8-13-11-15(18(24)25)9-7-14(13)12-16/h7-12,17H,2-6H2,1H3,(H,24,25) |
| InChIKey | GEHQVTHNPTUZLT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|