C20H23F3O4 — CID 67657308
(7-ethoxy-1,1,1-trifluoroheptan-2-yl) 6-hydroxynaphthalene-2-carboxylate (PubChem CID 67657308) has the molecular formula C20H23F3O4 and a molecular weight of 384.39 g/mol. Its IUPAC name is (7-ethoxy-1,1,1-trifluoroheptan-2-yl) 6-hydroxynaphthalene-2-carboxylate.
| Compound Name | (7-ethoxy-1,1,1-trifluoroheptan-2-yl) 6-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 67657308 |
| Molecular Formula | C20H23F3O4 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (7-ethoxy-1,1,1-trifluoroheptan-2-yl) 6-hydroxynaphthalene-2-carboxylate |
| SMILES | CCOCCCCCC(OC(=O)c1ccc2cc(O)ccc2c1)C(F)(F)F |
| InChI | InChI=1S/C20H23F3O4/c1-2-26-11-5-3-4-6-18(20(21,22)23)27-19(25)16-8-7-15-13-17(24)10-9-14(15)12-16/h7-10,12-13,18,24H,2-6,11H2,1H3 |
| InChIKey | QLBAWRMOEQZUMH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|