C36H45F3O4 — CID 67797801
1-octyl-4-phenylbenzene;4-(1,1,1-trifluorooctan-2-yloxycarbonyl)benzoic acid (PubChem CID 67797801) has the molecular formula C36H45F3O4 and a molecular weight of 598.75 g/mol. Its IUPAC name is 1-octyl-4-phenylbenzene;4-(1,1,1-trifluorooctan-2-yloxycarbonyl)benzoic acid.
| Compound Name | 1-octyl-4-phenylbenzene;4-(1,1,1-trifluorooctan-2-yloxycarbonyl)benzoic acid |
|---|---|
| PubChem CID | 67797801 |
| Molecular Formula | C36H45F3O4 |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.33 |
| IUPAC Name | 1-octyl-4-phenylbenzene;4-(1,1,1-trifluorooctan-2-yloxycarbonyl)benzoic acid |
| SMILES | CCCCCCC(OC(=O)c1ccc(C(=O)O)cc1)C(F)(F)F.CCCCCCCCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H26.C16H19F3O4/c1-2-3-4-5-6-8-11-18-14-16-20(17-15-18)19-12-9-7-10-13-19;1-2-3-4-5-6-13(16(17,18)19)23-15(22)12-9-7-11(8-10-12)14(20)21/h7,9-10,12-17H,2-6,8,11H2,1H3;7-10,13H,2-6H2,1H3,(H,20,21) |
| InChIKey | MVSWVXOBLLWDJQ-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|