C22H25F3O3 — CID 14549214
[(2S)-1,1,1-trifluorooctan-2-yl] 4-phenylmethoxybenzoate (PubChem CID 14549214) has the molecular formula C22H25F3O3 and a molecular weight of 394.43 g/mol. Its IUPAC name is [(2S)-1,1,1-trifluorooctan-2-yl] 4-phenylmethoxybenzoate.
| Compound Name | [(2S)-1,1,1-trifluorooctan-2-yl] 4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 14549214 |
| Molecular Formula | C22H25F3O3 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | [(2S)-1,1,1-trifluorooctan-2-yl] 4-phenylmethoxybenzoate |
| SMILES | CCCCCC[C@H](OC(=O)c1ccc(OCc2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C22H25F3O3/c1-2-3-4-8-11-20(22(23,24)25)28-21(26)18-12-14-19(15-13-18)27-16-17-9-6-5-7-10-17/h5-7,9-10,12-15,20H,2-4,8,11,16H2,1H3/t20-/m0/s1 |
| InChIKey | KKAZXWLDBFAZSV-FQEVSTJZSA-N |
| XLogP | 6.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|