C23H27F3O4 — CID 139665002
(1,1,1-trifluoro-3-hydroxynonan-2-yl) 4-phenylmethoxybenzoate (PubChem CID 139665002) has the molecular formula C23H27F3O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is (1,1,1-trifluoro-3-hydroxynonan-2-yl) 4-phenylmethoxybenzoate.
| Compound Name | (1,1,1-trifluoro-3-hydroxynonan-2-yl) 4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 139665002 |
| Molecular Formula | C23H27F3O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (1,1,1-trifluoro-3-hydroxynonan-2-yl) 4-phenylmethoxybenzoate |
| SMILES | CCCCCCC(O)C(OC(=O)c1ccc(OCc2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C23H27F3O4/c1-2-3-4-8-11-20(27)21(23(24,25)26)30-22(28)18-12-14-19(15-13-18)29-16-17-9-6-5-7-10-17/h5-7,9-10,12-15,20-21,27H,2-4,8,11,16H2,1H3 |
| InChIKey | XZHRUOXWZGVWKW-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|