C30H34O4 — CID 139788473
[(2S)-octan-2-yl] 3-oxo-3-[4-(4-phenylmethoxyphenyl)phenyl]propanoate (PubChem CID 139788473) has the molecular formula C30H34O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is [(2S)-octan-2-yl] 3-oxo-3-[4-(4-phenylmethoxyphenyl)phenyl]propanoate.
| Compound Name | [(2S)-octan-2-yl] 3-oxo-3-[4-(4-phenylmethoxyphenyl)phenyl]propanoate |
|---|---|
| PubChem CID | 139788473 |
| Molecular Formula | C30H34O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | [(2S)-octan-2-yl] 3-oxo-3-[4-(4-phenylmethoxyphenyl)phenyl]propanoate |
| SMILES | CCCCCC[C@H](C)OC(=O)CC(=O)c1ccc(-c2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H34O4/c1-3-4-5-7-10-23(2)34-30(32)21-29(31)27-15-13-25(14-16-27)26-17-19-28(20-18-26)33-22-24-11-8-6-9-12-24/h6,8-9,11-20,23H,3-5,7,10,21-22H2,1-2H3/t23-/m0/s1 |
| InChIKey | IVEBLYOUGIMXCE-QHCPKHFHSA-N |
| XLogP | 7.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|