C25H29F3O5 — CID 139713674
[(2S)-9-ethoxy-1,1,1-trifluoro-3-oxononan-2-yl] 4-phenylmethoxybenzoate (PubChem CID 139713674) has the molecular formula C25H29F3O5 and a molecular weight of 466.50 g/mol. Its IUPAC name is [(2S)-9-ethoxy-1,1,1-trifluoro-3-oxononan-2-yl] 4-phenylmethoxybenzoate.
| Compound Name | [(2S)-9-ethoxy-1,1,1-trifluoro-3-oxononan-2-yl] 4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 139713674 |
| Molecular Formula | C25H29F3O5 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | [(2S)-9-ethoxy-1,1,1-trifluoro-3-oxononan-2-yl] 4-phenylmethoxybenzoate |
| SMILES | CCOCCCCCCC(=O)[C@H](OC(=O)c1ccc(OCc2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C25H29F3O5/c1-2-31-17-9-4-3-8-12-22(29)23(25(26,27)28)33-24(30)20-13-15-21(16-14-20)32-18-19-10-6-5-7-11-19/h5-7,10-11,13-16,23H,2-4,8-9,12,17-18H2,1H3/t23-/m0/s1 |
| InChIKey | CCLILHJLZRMKOA-QHCPKHFHSA-N |
| XLogP | 5.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|