C28H33F3O7 — CID 22913511
[4-(1,1,1-trifluoro-3-oxo-3-pentoxypropan-2-yl)oxycarbonylphenyl] 4-hexoxybenzoate (PubChem CID 22913511) has the molecular formula C28H33F3O7 and a molecular weight of 538.56 g/mol. Its IUPAC name is [4-(1,1,1-trifluoro-3-oxo-3-pentoxypropan-2-yl)oxycarbonylphenyl] 4-hexoxybenzoate.
| Compound Name | [4-(1,1,1-trifluoro-3-oxo-3-pentoxypropan-2-yl)oxycarbonylphenyl] 4-hexoxybenzoate |
|---|---|
| PubChem CID | 22913511 |
| Molecular Formula | C28H33F3O7 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | [4-(1,1,1-trifluoro-3-oxo-3-pentoxypropan-2-yl)oxycarbonylphenyl] 4-hexoxybenzoate |
| SMILES | CCCCCCOc1ccc(C(=O)Oc2ccc(C(=O)OC(C(=O)OCCCCC)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H33F3O7/c1-3-5-7-9-18-35-22-14-10-20(11-15-22)25(32)37-23-16-12-21(13-17-23)26(33)38-24(28(29,30)31)27(34)36-19-8-6-4-2/h10-17,24H,3-9,18-19H2,1-2H3 |
| InChIKey | AKGYUQHTDFMZJH-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|