C30H37F3O6 — CID 22913203
[4-(1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl)oxycarbonylphenyl] 4-decylbenzoate (PubChem CID 22913203) has the molecular formula C30H37F3O6 and a molecular weight of 550.61 g/mol. Its IUPAC name is [4-(1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl)oxycarbonylphenyl] 4-decylbenzoate.
| Compound Name | [4-(1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl)oxycarbonylphenyl] 4-decylbenzoate |
|---|---|
| PubChem CID | 22913203 |
| Molecular Formula | C30H37F3O6 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | [4-(1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl)oxycarbonylphenyl] 4-decylbenzoate |
| SMILES | CCCCCCCCCCc1ccc(C(=O)Oc2ccc(C(=O)OC(C(=O)OCCC)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H37F3O6/c1-3-5-6-7-8-9-10-11-12-22-13-15-23(16-14-22)27(34)38-25-19-17-24(18-20-25)28(35)39-26(30(31,32)33)29(36)37-21-4-2/h13-20,26H,3-12,21H2,1-2H3 |
| InChIKey | UDFZAYYLTCRSKS-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|