C30H33F3N2O4 — CID 22913559
(3-butoxy-1,1,1-trifluoro-3-oxopropan-2-yl) 4-[2-(4-hexylphenyl)pyrimidin-5-yl]benzoate (PubChem CID 22913559) has the molecular formula C30H33F3N2O4 and a molecular weight of 542.60 g/mol. Its IUPAC name is (3-butoxy-1,1,1-trifluoro-3-oxopropan-2-yl) 4-[2-(4-hexylphenyl)pyrimidin-5-yl]benzoate.
| Compound Name | (3-butoxy-1,1,1-trifluoro-3-oxopropan-2-yl) 4-[2-(4-hexylphenyl)pyrimidin-5-yl]benzoate |
|---|---|
| PubChem CID | 22913559 |
| Molecular Formula | C30H33F3N2O4 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | (3-butoxy-1,1,1-trifluoro-3-oxopropan-2-yl) 4-[2-(4-hexylphenyl)pyrimidin-5-yl]benzoate |
| SMILES | CCCCCCc1ccc(-c2ncc(-c3ccc(C(=O)OC(C(=O)OCCCC)C(F)(F)F)cc3)cn2)cc1 |
| InChI | InChI=1S/C30H33F3N2O4/c1-3-5-7-8-9-21-10-12-23(13-11-21)27-34-19-25(20-35-27)22-14-16-24(17-15-22)28(36)39-26(30(31,32)33)29(37)38-18-6-4-2/h10-17,19-20,26H,3-9,18H2,1-2H3 |
| InChIKey | FGFKMQZCSZZWEP-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|