C35H39F3O7 — CID 23198270
[4-(3-butoxy-1,1,1-trifluoro-3-oxopropan-2-yl)oxycarbonylphenyl] 4-(4-octoxyphenyl)benzoate (PubChem CID 23198270) has the molecular formula C35H39F3O7 and a molecular weight of 628.68 g/mol. Its IUPAC name is [4-(3-butoxy-1,1,1-trifluoro-3-oxopropan-2-yl)oxycarbonylphenyl] 4-(4-octoxyphenyl)benzoate.
| Compound Name | [4-(3-butoxy-1,1,1-trifluoro-3-oxopropan-2-yl)oxycarbonylphenyl] 4-(4-octoxyphenyl)benzoate |
|---|---|
| PubChem CID | 23198270 |
| Molecular Formula | C35H39F3O7 |
| Molecular Weight | 628.68 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | [4-(3-butoxy-1,1,1-trifluoro-3-oxopropan-2-yl)oxycarbonylphenyl] 4-(4-octoxyphenyl)benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OC(C(=O)OCCCC)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H39F3O7/c1-3-5-7-8-9-10-24-42-29-19-15-26(16-20-29)25-11-13-27(14-12-25)32(39)44-30-21-17-28(18-22-30)33(40)45-31(35(36,37)38)34(41)43-23-6-4-2/h11-22,31H,3-10,23-24H2,1-2H3 |
| InChIKey | TYIBBMJQROMPRF-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.68 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|