C34H37F3O6 — CID 22913544
[4-(1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl)oxycarbonylphenyl] 4-(4-octylphenyl)benzoate (PubChem CID 22913544) has the molecular formula C34H37F3O6 and a molecular weight of 598.66 g/mol. Its IUPAC name is [4-(1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl)oxycarbonylphenyl] 4-(4-octylphenyl)benzoate.
| Compound Name | [4-(1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl)oxycarbonylphenyl] 4-(4-octylphenyl)benzoate |
|---|---|
| PubChem CID | 22913544 |
| Molecular Formula | C34H37F3O6 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.25 |
| IUPAC Name | [4-(1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl)oxycarbonylphenyl] 4-(4-octylphenyl)benzoate |
| SMILES | CCCCCCCCc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OC(C(=O)OCCC)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H37F3O6/c1-3-5-6-7-8-9-10-24-11-13-25(14-12-24)26-15-17-27(18-16-26)31(38)42-29-21-19-28(20-22-29)32(39)43-30(34(35,36)37)33(40)41-23-4-2/h11-22,30H,3-10,23H2,1-2H3 |
| InChIKey | YIQLMXLELASNKQ-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|