C33H43F3N2O2 — CID 22913252
2-(4-nonylphenyl)-5-[4-(3,3,3-trifluoro-2-pentoxypropoxy)phenyl]pyrimidine (PubChem CID 22913252) has the molecular formula C33H43F3N2O2 and a molecular weight of 556.71 g/mol. Its IUPAC name is 2-(4-nonylphenyl)-5-[4-(3,3,3-trifluoro-2-pentoxypropoxy)phenyl]pyrimidine.
| Compound Name | 2-(4-nonylphenyl)-5-[4-(3,3,3-trifluoro-2-pentoxypropoxy)phenyl]pyrimidine |
|---|---|
| PubChem CID | 22913252 |
| Molecular Formula | C33H43F3N2O2 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | 2-(4-nonylphenyl)-5-[4-(3,3,3-trifluoro-2-pentoxypropoxy)phenyl]pyrimidine |
| SMILES | CCCCCCCCCc1ccc(-c2ncc(-c3ccc(OCC(OCCCCC)C(F)(F)F)cc3)cn2)cc1 |
| InChI | InChI=1S/C33H43F3N2O2/c1-3-5-7-8-9-10-11-13-26-14-16-28(17-15-26)32-37-23-29(24-38-32)27-18-20-30(21-19-27)40-25-31(33(34,35)36)39-22-12-6-4-2/h14-21,23-24,31H,3-13,22,25H2,1-2H3 |
| InChIKey | QTZNEHGJPYAQLA-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|