C26H37F3N2O3 — CID 22913395
5-[4-(2-butoxy-3,3,3-trifluoropropoxy)phenyl]-2-nonoxypyrimidine (PubChem CID 22913395) has the molecular formula C26H37F3N2O3 and a molecular weight of 482.59 g/mol. Its IUPAC name is 5-[4-(2-butoxy-3,3,3-trifluoropropoxy)phenyl]-2-nonoxypyrimidine.
| Compound Name | 5-[4-(2-butoxy-3,3,3-trifluoropropoxy)phenyl]-2-nonoxypyrimidine |
|---|---|
| PubChem CID | 22913395 |
| Molecular Formula | C26H37F3N2O3 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | 5-[4-(2-butoxy-3,3,3-trifluoropropoxy)phenyl]-2-nonoxypyrimidine |
| SMILES | CCCCCCCCCOc1ncc(-c2ccc(OCC(OCCCC)C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C26H37F3N2O3/c1-3-5-7-8-9-10-11-17-33-25-30-18-22(19-31-25)21-12-14-23(15-13-21)34-20-24(26(27,28)29)32-16-6-4-2/h12-15,18-19,24H,3-11,16-17,20H2,1-2H3 |
| InChIKey | IZERTYDHBRMZRP-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|