C28H46N2O2Si — CID 18964605
ethyl-dimethyl-[6-[4-(2-octoxypyrimidin-5-yl)phenoxy]hexyl]silane (PubChem CID 18964605) has the molecular formula C28H46N2O2Si and a molecular weight of 470.77 g/mol. Its IUPAC name is ethyl-dimethyl-[6-[4-(2-octoxypyrimidin-5-yl)phenoxy]hexyl]silane.
| Compound Name | ethyl-dimethyl-[6-[4-(2-octoxypyrimidin-5-yl)phenoxy]hexyl]silane |
|---|---|
| PubChem CID | 18964605 |
| Molecular Formula | C28H46N2O2Si |
| Molecular Weight | 470.77 g/mol |
| Exact Mass | 470.33 |
| IUPAC Name | ethyl-dimethyl-[6-[4-(2-octoxypyrimidin-5-yl)phenoxy]hexyl]silane |
| SMILES | CCCCCCCCOc1ncc(-c2ccc(OCCCCCC[Si](C)(C)CC)cc2)cn1 |
| InChI | InChI=1S/C28H46N2O2Si/c1-5-7-8-9-10-14-21-32-28-29-23-26(24-30-28)25-16-18-27(19-17-25)31-20-13-11-12-15-22-33(3,4)6-2/h16-19,23-24H,5-15,20-22H2,1-4H3 |
| InChIKey | INUYXDXRWYHAJY-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.77 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|