C28H32F3NO2 — CID 22913337
2-[4-[4-(2-butoxy-3,3,3-trifluoropropoxy)phenyl]phenyl]-5-butylpyridine (PubChem CID 22913337) has the molecular formula C28H32F3NO2 and a molecular weight of 471.56 g/mol. Its IUPAC name is 2-[4-[4-(2-butoxy-3,3,3-trifluoropropoxy)phenyl]phenyl]-5-butylpyridine.
| Compound Name | 2-[4-[4-(2-butoxy-3,3,3-trifluoropropoxy)phenyl]phenyl]-5-butylpyridine |
|---|---|
| PubChem CID | 22913337 |
| Molecular Formula | C28H32F3NO2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 2-[4-[4-(2-butoxy-3,3,3-trifluoropropoxy)phenyl]phenyl]-5-butylpyridine |
| SMILES | CCCCOC(COc1ccc(-c2ccc(-c3ccc(CCCC)cn3)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C28H32F3NO2/c1-3-5-7-21-8-17-26(32-19-21)24-11-9-22(10-12-24)23-13-15-25(16-14-23)34-20-27(28(29,30)31)33-18-6-4-2/h8-17,19,27H,3-7,18,20H2,1-2H3 |
| InChIKey | OHUMHQZQVNVXAH-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|