C23H31F3N2O2 — CID 22913188
2-[4-(2-butoxy-3,3,3-trifluoropropoxy)phenyl]-5-hexylpyrimidine (PubChem CID 22913188) has the molecular formula C23H31F3N2O2 and a molecular weight of 424.51 g/mol. Its IUPAC name is 2-[4-(2-butoxy-3,3,3-trifluoropropoxy)phenyl]-5-hexylpyrimidine.
| Compound Name | 2-[4-(2-butoxy-3,3,3-trifluoropropoxy)phenyl]-5-hexylpyrimidine |
|---|---|
| PubChem CID | 22913188 |
| Molecular Formula | C23H31F3N2O2 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 2-[4-(2-butoxy-3,3,3-trifluoropropoxy)phenyl]-5-hexylpyrimidine |
| SMILES | CCCCCCc1cnc(-c2ccc(OCC(OCCCC)C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C23H31F3N2O2/c1-3-5-7-8-9-18-15-27-22(28-16-18)19-10-12-20(13-11-19)30-17-21(23(24,25)26)29-14-6-4-2/h10-13,15-16,21H,3-9,14,17H2,1-2H3 |
| InChIKey | ZWQSXBSKKPSTJV-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|