C24H36N2O2 — CID 18997731
5-octyl-2-[4-(2-propoxypropoxy)phenyl]pyrimidine (PubChem CID 18997731) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is 5-octyl-2-[4-(2-propoxypropoxy)phenyl]pyrimidine.
| Compound Name | 5-octyl-2-[4-(2-propoxypropoxy)phenyl]pyrimidine |
|---|---|
| PubChem CID | 18997731 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 5-octyl-2-[4-(2-propoxypropoxy)phenyl]pyrimidine |
| SMILES | CCCCCCCCc1cnc(-c2ccc(OCC(C)OCCC)cc2)nc1 |
| InChI | InChI=1S/C24H36N2O2/c1-4-6-7-8-9-10-11-21-17-25-24(26-18-21)22-12-14-23(15-13-22)28-19-20(3)27-16-5-2/h12-15,17-18,20H,4-11,16,19H2,1-3H3 |
| InChIKey | OTLRBIXAWCFILD-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|