C31H40N2O4 — CID 19866153
1-[4-[2-(4-hexylphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-propoxypropanoate (PubChem CID 19866153) has the molecular formula C31H40N2O4 and a molecular weight of 504.67 g/mol. Its IUPAC name is 1-[4-[2-(4-hexylphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-propoxypropanoate.
| Compound Name | 1-[4-[2-(4-hexylphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-propoxypropanoate |
|---|---|
| PubChem CID | 19866153 |
| Molecular Formula | C31H40N2O4 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | 1-[4-[2-(4-hexylphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-propoxypropanoate |
| SMILES | CCCCCCc1ccc(-c2ncc(-c3ccc(OCC(C)OC(=O)C(C)OCCC)cc3)cn2)cc1 |
| InChI | InChI=1S/C31H40N2O4/c1-5-7-8-9-10-25-11-13-27(14-12-25)30-32-20-28(21-33-30)26-15-17-29(18-16-26)36-22-23(3)37-31(34)24(4)35-19-6-2/h11-18,20-21,23-24H,5-10,19,22H2,1-4H3 |
| InChIKey | IZJIOEQQNUJZBO-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|