C29H36N2O5 — CID 19866106
1-[4-[2-(4-propoxyphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-butoxypropanoate (PubChem CID 19866106) has the molecular formula C29H36N2O5 and a molecular weight of 492.62 g/mol. Its IUPAC name is 1-[4-[2-(4-propoxyphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-butoxypropanoate.
| Compound Name | 1-[4-[2-(4-propoxyphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-butoxypropanoate |
|---|---|
| PubChem CID | 19866106 |
| Molecular Formula | C29H36N2O5 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | 1-[4-[2-(4-propoxyphenyl)pyrimidin-5-yl]phenoxy]propan-2-yl 2-butoxypropanoate |
| SMILES | CCCCOC(C)C(=O)OC(C)COc1ccc(-c2cnc(-c3ccc(OCCC)cc3)nc2)cc1 |
| InChI | InChI=1S/C29H36N2O5/c1-5-7-17-33-22(4)29(32)36-21(3)20-35-27-12-8-23(9-13-27)25-18-30-28(31-19-25)24-10-14-26(15-11-24)34-16-6-2/h8-15,18-19,21-22H,5-7,16-17,20H2,1-4H3 |
| InChIKey | PNZRFBOFAQGKAM-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|