About 1-phenoxypropan-2-yl 2-propoxypropanoate
1-phenoxypropan-2-yl 2-propoxypropanoate (PubChem CID 173394224) has the molecular formula C15H22O4
and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-phenoxypropan-2-yl 2-propoxypropanoate.
Molecular Properties
| Compound Name | 1-phenoxypropan-2-yl 2-propoxypropanoate |
| PubChem CID | 173394224 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-phenoxypropan-2-yl 2-propoxypropanoate |
| SMILES | CCCOC(C)C(=O)OC(C)COc1ccccc1 |
| InChI | InChI=1S/C15H22O4/c1-4-10-17-13(3)15(16)19-12(2)11-18-14-8-6-5-7-9-14/h5-9,12-13H,4,10-11H2,1-3H3 |
| InChIKey | GTLZRPDMZOJURH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-phenoxypropan-2-yl 2-propoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenoxypropan-2-yl 2-propoxypropanoate?
The IUPAC name of 1-phenoxypropan-2-yl 2-propoxypropanoate (CID 173394224) is 1-phenoxypropan-2-yl 2-propoxypropanoate.
What is the SMILES notation for 1-phenoxypropan-2-yl 2-propoxypropanoate?
The canonical SMILES for 1-phenoxypropan-2-yl 2-propoxypropanoate is CCCOC(C)C(=O)OC(C)COc1ccccc1.
What is the InChIKey of 1-phenoxypropan-2-yl 2-propoxypropanoate?
The InChIKey is GTLZRPDMZOJURH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O4/c1-4-10-17-13(3)15(16)19-12(2)11-18-14-8-6-5-7-9-14/h5-9,12-13H,4,10-11H2,1-3H3.
What are the key properties of 1-phenoxypropan-2-yl 2-propoxypropanoate?
1-phenoxypropan-2-yl 2-propoxypropanoate has a molecular weight of 266.34 g/mol, XLogP of 2.81, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenoxypropan-2-yl 2-propoxypropanoate is sourced from PubChem (CID 173394224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).