C18H26O5 — CID 69379024
1-[1-(1-phenoxypropan-2-yloxy)propan-2-yloxy]propan-2-yl prop-2-enoate (PubChem CID 69379024) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is 1-[1-(1-phenoxypropan-2-yloxy)propan-2-yloxy]propan-2-yl prop-2-enoate.
| Compound Name | 1-[1-(1-phenoxypropan-2-yloxy)propan-2-yloxy]propan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 69379024 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 1-[1-(1-phenoxypropan-2-yloxy)propan-2-yloxy]propan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)COC(C)COC(C)COc1ccccc1 |
| InChI | InChI=1S/C18H26O5/c1-5-18(19)23-16(4)13-21-14(2)11-20-15(3)12-22-17-9-7-6-8-10-17/h5-10,14-16H,1,11-13H2,2-4H3 |
| InChIKey | PBVIZDNEUXYTCP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|