C12H15NO3 — CID 69463364
(2-amino-3-phenoxypropyl) prop-2-enoate (PubChem CID 69463364) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is (2-amino-3-phenoxypropyl) prop-2-enoate.
| Compound Name | (2-amino-3-phenoxypropyl) prop-2-enoate |
|---|---|
| PubChem CID | 69463364 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (2-amino-3-phenoxypropyl) prop-2-enoate |
| SMILES | C=CC(=O)OCC(N)COc1ccccc1 |
| InChI | InChI=1S/C12H15NO3/c1-2-12(14)16-9-10(13)8-15-11-6-4-3-5-7-11/h2-7,10H,1,8-9,13H2 |
| InChIKey | ICVPACNMRRSQKF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|