C16H16O4 — CID 58021551
(2-hydroxy-3-naphthalen-2-yloxypropyl) prop-2-enoate (PubChem CID 58021551) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is (2-hydroxy-3-naphthalen-2-yloxypropyl) prop-2-enoate.
| Compound Name | (2-hydroxy-3-naphthalen-2-yloxypropyl) prop-2-enoate |
|---|---|
| PubChem CID | 58021551 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (2-hydroxy-3-naphthalen-2-yloxypropyl) prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H16O4/c1-2-16(18)20-11-14(17)10-19-15-8-7-12-5-3-4-6-13(12)9-15/h2-9,14,17H,1,10-11H2 |
| InChIKey | JRHAELPNGBUIAH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|