C12H12Br2O4 — CID 101144744
[3-(3,4-dibromophenoxy)-2-hydroxypropyl] prop-2-enoate (PubChem CID 101144744) has the molecular formula C12H12Br2O4 and a molecular weight of 380.03 g/mol. Its IUPAC name is [3-(3,4-dibromophenoxy)-2-hydroxypropyl] prop-2-enoate.
| Compound Name | [3-(3,4-dibromophenoxy)-2-hydroxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 101144744 |
| Molecular Formula | C12H12Br2O4 |
| Molecular Weight | 380.03 g/mol |
| Exact Mass | 377.91 |
| IUPAC Name | [3-(3,4-dibromophenoxy)-2-hydroxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)COc1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C12H12Br2O4/c1-2-12(16)18-7-8(15)6-17-9-3-4-10(13)11(14)5-9/h2-5,8,15H,1,6-7H2 |
| InChIKey | PHAFXPGFDZZPQQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.03 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|