C34H40O8 — CID 59459893
[2-hydroxy-3-[4-[2-[4-(2-hydroxy-3-prop-2-enoyloxypropoxy)phenyl]-2-adamantyl]phenoxy]propyl] prop-2-enoate (PubChem CID 59459893) has the molecular formula C34H40O8 and a molecular weight of 576.69 g/mol. Its IUPAC name is [2-hydroxy-3-[4-[2-[4-(2-hydroxy-3-prop-2-enoyloxypropoxy)phenyl]-2-adamantyl]phenoxy]propyl] prop-2-enoate.
| Compound Name | [2-hydroxy-3-[4-[2-[4-(2-hydroxy-3-prop-2-enoyloxypropoxy)phenyl]-2-adamantyl]phenoxy]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 59459893 |
| Molecular Formula | C34H40O8 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | [2-hydroxy-3-[4-[2-[4-(2-hydroxy-3-prop-2-enoyloxypropoxy)phenyl]-2-adamantyl]phenoxy]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)COc1ccc(C2(c3ccc(OCC(O)COC(=O)C=C)cc3)C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C34H40O8/c1-3-32(37)41-20-28(35)18-39-30-9-5-24(6-10-30)34(26-14-22-13-23(16-26)17-27(34)15-22)25-7-11-31(12-8-25)40-19-29(36)21-42-33(38)4-2/h3-12,22-23,26-29,35-36H,1-2,13-21H2 |
| InChIKey | GBHZVOVGKAEJRA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|